EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N2O3 |
| Net Charge | 0 |
| Average Mass | 366.461 |
| Monoisotopic Mass | 366.19434 |
| SMILES | [H][C@]12N3CCC[C@]14CC[C@]1([C@H](C(=O)OC)C4)N(C=O)c4ccccc4[C@]21CC3 |
| InChI | InChI=1S/C22H26N2O3/c1-27-18(26)16-13-20-7-4-11-23-12-10-21(19(20)23)15-5-2-3-6-17(15)24(14-25)22(16,21)9-8-20/h2-3,5-6,14,16,19H,4,7-13H2,1H3/t16-,19-,20+,21+,22+/m0/s1 |
| InChIKey | XGYZDZNXCXHGBV-WVCANSMHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspidofractine (CHEBI:2887) is a indole alkaloid (CHEBI:38958) |
| Aspidofractine (CHEBI:2887) is a methyl ester (CHEBI:25248) |
| Synonym | Source |
|---|---|
| Aspidofractine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C09040 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:2348-67-6 | KEGG COMPOUND |