EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6O4 |
| Net Charge | 0 |
| Average Mass | 190.154 |
| Monoisotopic Mass | 190.02661 |
| SMILES | O=C1C=CC(=O)c2c(O)ccc(O)c21 |
| InChI | InChI=1S/C10H6O4/c11-5-1-2-6(12)10-8(14)4-3-7(13)9(5)10/h1-4,11-12H |
| InChIKey | RQNVIKXOOKXAJQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naphthazarin (CHEBI:28849) has role acaricide (CHEBI:22153) |
| naphthazarin (CHEBI:28849) has role antibacterial agent (CHEBI:33282) |
| naphthazarin (CHEBI:28849) has role antineoplastic agent (CHEBI:35610) |
| naphthazarin (CHEBI:28849) has role apoptosis inducer (CHEBI:68495) |
| naphthazarin (CHEBI:28849) has role geroprotector (CHEBI:176497) |
| naphthazarin (CHEBI:28849) has role plant metabolite (CHEBI:76924) |
| naphthazarin (CHEBI:28849) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| IUPAC Name |
|---|
| 5,8-dihydroxy-1,4-naphthoquinone |
| Synonyms | Source |
|---|---|
| 5,8-dihydroxy-1,4-naphthalenedione | ChemIDplus |
| 5,8-dihydroxy-1,4-naphthosemiquinone | ChemIDplus |
| 5,8-dihydroxynaphthoquinone | NIST Chemistry WebBook |
| naphthazarine | ChemIDplus |
| naphthazarone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 5,8-Dihydroxy-1,4-naphthoquinone | Wikipedia |
| C00002846 | KNApSAcK |
| C01938 | KEGG COMPOUND |
| Citations |
|---|