EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25N5O15P2 |
| Net Charge | 0 |
| Average Mass | 589.344 |
| Monoisotopic Mass | 589.08224 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H25N5O15P2/c17-13-7-14(19-3-18-13)21(4-20-7)15-11(26)9(24)6(33-15)2-32-37(28,29)36-38(30,31)35-16-12(27)10(25)8(23)5(1-22)34-16/h3-6,8-12,15-16,22-27H,1-2H2,(H,28,29)(H,30,31)(H2,17,18,19)/t5-,6-,8-,9-,10+,11-,12+,15-,16-/m1/s1 |
| InChIKey | WFPZSXYXPSUOPY-RYRBFGMPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ADP-α-D-mannose (CHEBI:28845) has role human metabolite (CHEBI:77746) |
| ADP-α-D-mannose (CHEBI:28845) is a ADP-aldose (CHEBI:17193) |
| Incoming Relation(s) |
| ADP-alpha-D-mannose(2-) (CHEBI:746983) is conjugate base of ADP-α-D-mannose (CHEBI:28845) |
| IUPAC Name |
|---|
| adenosine 5'-[3-(α-D-mannopyranosyl) dihydrogen diphosphate] |
| Synonyms | Source |
|---|---|
| ADPmannose | KEGG COMPOUND |
| APD-D-mannose | KEGG COMPOUND |
| Adenosine diphosphate-mannose | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C06192 | KEGG COMPOUND |
| HMDB0006369 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1207860 | Reaxys |