EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O6 |
| Net Charge | 0 |
| Average Mass | 346.379 |
| Monoisotopic Mass | 346.14164 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]23C=C[C@H](O)[C@@]1(C)C(=O)O3 |
| InChI | InChI=1S/C19H22O6/c1-9-7-17-8-18(9,24)5-3-10(17)19-6-4-11(20)16(2,15(23)25-19)13(19)12(17)14(21)22/h4,6,10-13,20,24H,1,3,5,7-8H2,2H3,(H,21,22)/t10-,11+,12-,13-,16-,17+,18+,19-/m1/s1 |
| InChIKey | IXORZMNAPKEEDV-OBDJNFEBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gibberella fujikuroi (ncbitaxon:5127) | - | PubMed (24232845) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A3 (CHEBI:28833) has role mouse metabolite (CHEBI:75771) |
| gibberellin A3 (CHEBI:28833) has role plant metabolite (CHEBI:76924) |
| gibberellin A3 (CHEBI:28833) is a C19-gibberellin (CHEBI:20858) |
| gibberellin A3 (CHEBI:28833) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A3 (CHEBI:28833) is a lactone (CHEBI:25000) |
| gibberellin A3 (CHEBI:28833) is a organic heteropentacyclic compound (CHEBI:38164) |
| gibberellin A3 (CHEBI:28833) is conjugate acid of gibberellin A3(1−) (CHEBI:58590) |
| Incoming Relation(s) |
| gibberellin A3 O-β-D-glucoside (CHEBI:52076) has functional parent gibberellin A3 (CHEBI:28833) |
| gibberellin A3 methyl ester (CHEBI:73253) has functional parent gibberellin A3 (CHEBI:28833) |
| gibberellin A3 norketone (CHEBI:142027) has functional parent gibberellin A3 (CHEBI:28833) |
| gibberellin A3(1−) (CHEBI:58590) is conjugate base of gibberellin A3 (CHEBI:28833) |
| IUPAC Names |
|---|
| (1R,2R,5S,8S,9S,10R,11S,12S)-5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid |
| 2β,7α-dihydroxy-1β-methyl-8-methylidene-13-oxo-4a,1α-epoxymethano-4aα,4bβ-gibb-3-ene-10β-carboxylic acid |
| Synonyms | Source |
|---|---|
| GA3 | ChEBI |
| GA3 | ChEBI |
| (+)-gibberellic acid | ChEBI |
| gibberellic acid | ChemIDplus |
| gibberellic acid GA3 | ChemIDplus |
| Gibberellin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 371 | BPDB |
| C00000003 | KNApSAcK |
| C01699 | KEGG COMPOUND |
| DB07814 | DrugBank |
| GA3 | PDBeChem |
| Gibberellic_acid | Wikipedia |
| GIBBERELLIN | MetaCyc |
| HMDB0003559 | HMDB |
| LMPR0104170002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:54346 | Reaxys |
| CAS:77-06-5 | KEGG COMPOUND |
| CAS:77-06-5 | ChemIDplus |
| Citations |
|---|