EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32O14 |
| Net Charge | 0 |
| Average Mass | 580.539 |
| Monoisotopic Mass | 580.17921 |
| SMILES | C[C@@H]1O[C@@H](O[C@H]2[C@H](Oc3cc(O)c4c(c3)O[C@H](c3ccc(O)cc3)CC4=O)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H32O14/c1-10-20(32)22(34)24(36)26(37-10)41-25-23(35)21(33)18(9-28)40-27(25)38-13-6-14(30)19-15(31)8-16(39-17(19)7-13)11-2-4-12(29)5-3-11/h2-7,10,16,18,20-30,32-36H,8-9H2,1H3/t10-,16-,18+,20-,21+,22+,23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | DFPMSGMNTNDNHN-ZPHOTFPESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naringin (CHEBI:28819) has functional parent (S)-naringenin (CHEBI:17846) |
| naringin (CHEBI:28819) has role anti-inflammatory agent (CHEBI:67079) |
| naringin (CHEBI:28819) has role antineoplastic agent (CHEBI:35610) |
| naringin (CHEBI:28819) has role metabolite (CHEBI:25212) |
| naringin (CHEBI:28819) is a (2S)-flavan-4-one (CHEBI:140377) |
| naringin (CHEBI:28819) is a 4'-hydroxyflavanones (CHEBI:140331) |
| naringin (CHEBI:28819) is a dihydroxyflavanone (CHEBI:38749) |
| naringin (CHEBI:28819) is a disaccharide derivative (CHEBI:63353) |
| naringin (CHEBI:28819) is a neohesperidoside (CHEBI:25495) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-3,4-dihydro-2H-chromen-7-yl 2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Naringenin 7-O-α-L-rhamnosyl-(1→2)-β-D-glucoside | ChEBI |
| Naringenin 7-O-[alpha-L-rhamnosyl-(1->2)-beta-D-glucoside] | KEGG COMPOUND |
| Naringenin 7-O-neohesperidoside | KEGG COMPOUND |
| Naringin | KEGG COMPOUND |
| Naringoside | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:102012 | Reaxys |
| CAS:10236-47-2 | KEGG COMPOUND |
| CAS:10236-47-2 | ChemIDplus |
| Citations |
|---|