EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O11 |
| Net Charge | 0 |
| Average Mass | 414.363 |
| Monoisotopic Mass | 414.11621 |
| SMILES | [H][C@@]12C3=CO[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@]1([H])C(COC(C)=O)=C[C@]2([H])OC3=O |
| InChI | InChI=1S/C18H22O11/c1-6(20)25-4-7-2-9-12-8(16(24)27-9)5-26-17(11(7)12)29-18-15(23)14(22)13(21)10(3-19)28-18/h2,5,9-15,17-19,21-23H,3-4H2,1H3/t9-,10+,11+,12-,13+,14-,15+,17-,18-/m0/s1 |
| InChIKey | IBIPGYWNOBGEMH-DILZHRMZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asperuloside (CHEBI:2881) has role metabolite (CHEBI:25212) |
| asperuloside (CHEBI:2881) is a acetate ester (CHEBI:47622) |
| asperuloside (CHEBI:2881) is a iridoid monoterpenoid (CHEBI:50563) |
| asperuloside (CHEBI:2881) is a monosaccharide derivative (CHEBI:63367) |
| asperuloside (CHEBI:2881) is a β-D-glucoside (CHEBI:22798) |
| asperuloside (CHEBI:2881) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| [(2aS,4aS,5S,7bS)-5-(β-D-glucopyranosyloxy)-1-oxo-2a,4a,5,7b-tetrahydro-1H-2,6-dioxacyclopenta[cd]inden-4-yl]methyl acetate |
| Manual Xrefs | Databases |
|---|---|
| C00003072 | KNApSAcK |
| C09769 | KEGG COMPOUND |
| JP2009209088 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1302815 | Reaxys |
| CAS:14259-45-1 | KEGG COMPOUND |
| CAS:14259-45-1 | ChemIDplus |
| Citations |
|---|