EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28791 - isoglutamic acid
| Formula | C5H9NO4 |
| Net Charge | 0 |
| Average Mass | 147.130 |
| Monoisotopic Mass | 147.05316 |
| SMILES | NC(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C5H9NO4/c6-3(1-4(7)8)2-5(9)10/h3H,1-2,6H2,(H,7,8)(H,9,10) |
| InChIKey | BBJIPMIXTXKYLZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoglutamic acid (CHEBI:28791) has functional parent glutaric acid (CHEBI:17859) |
| isoglutamic acid (CHEBI:28791) has role algal metabolite (CHEBI:84735) |
| isoglutamic acid (CHEBI:28791) has role marine metabolite (CHEBI:76507) |
| isoglutamic acid (CHEBI:28791) is a dicarboxylic acid (CHEBI:35692) |
| isoglutamic acid (CHEBI:28791) is conjugate acid of isoglutamate(1−) (CHEBI:66948) |
| Incoming Relation(s) |
| isoglutamate(1−) (CHEBI:66948) is conjugate base of isoglutamic acid (CHEBI:28791) |
| IUPAC Name |
|---|
| 3-aminopentanedioic acid |
| Synonyms | Source |
|---|---|
| Isoglutamic acid | KEGG COMPOUND |
| 3-Aminopentanedioic acid | KEGG COMPOUND |
| 3-Aminoglutaric acid | ChemIDplus |
| 3-Aminoglutarate | ChemIDplus |
| beta-Aminoglutaric acid | ChemIDplus |
| beta-Glutamic acid | ChemIDplus |
| Citations |
|---|