EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2878 - Aspecioside
| Formula | C29H42O10 |
| Net Charge | 0 |
| Average Mass | 550.645 |
| Monoisotopic Mass | 550.27780 |
| SMILES | [H][C@]12C[C@@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@@H](O)[C@H]3O)CC[C@]1(C)[C@@]1([H])C[C@@H](O)[C@@]3(C)[C@](O)(CC[C@]3([H])C3=CC(=O)OC3)[C@@]13O[C@H]3C2 |
| InChI | InChI=1S/C29H42O10/c1-13-22(32)23(33)24(34)25(37-13)38-16-4-6-26(2)15(9-16)10-20-29(39-20)18(26)11-19(30)27(3)17(5-7-28(27,29)35)14-8-21(31)36-12-14/h8,13,15-20,22-25,30,32-35H,4-7,9-12H2,1-3H3/t13-,15-,16+,17-,18-,19-,20+,22-,23-,24-,25+,26+,27+,28-,29-/m1/s1 |
| InChIKey | BEDAFJYDKDOALK-FHLCUQDTSA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspecioside (CHEBI:2878) is a cardenolide glycoside (CHEBI:38092) |
| Synonym | Source |
|---|---|
| Aspecioside | KEGG COMPOUND |