EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12I3NO4 |
| Net Charge | 0 |
| Average Mass | 650.976 |
| Monoisotopic Mass | 650.79005 |
| SMILES | NC(Cc1ccc(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C15H12I3NO4/c16-9-3-7(4-12(19)15(21)22)1-2-13(9)23-8-5-10(17)14(20)11(18)6-8/h1-3,5-6,12,20H,4,19H2,(H,21,22) |
| InChIKey | HZCBWYNLGPIQRK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3',5'-triiodothyronine (CHEBI:28774) has role human metabolite (CHEBI:77746) |
| 3,3',5'-triiodothyronine (CHEBI:28774) is a iodothyronine (CHEBI:24864) |
| Incoming Relation(s) |
| 3,3',5'-triiodo-D-thyronine (CHEBI:232361) is a 3,3',5'-triiodothyronine (CHEBI:28774) |
| 3,3',5'-triiodo-L-thyronine (CHEBI:11684) is a 3,3',5'-triiodothyronine (CHEBI:28774) |
| IUPAC Name |
|---|
| 3,3',5'-triiodothyronine |
| Synonyms | Source |
|---|---|
| 3,3',5'-Triiodothyronine | KEGG COMPOUND |
| 4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenylalanine | IUPAC |
| O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine | IUPAC |
| Reverse triiodothyronine | ChemIDplus |
| Triiodothyronine, reverse | KEGG COMPOUND |