EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28772 - α-L-arabinofuranose
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | OC[C@@H]1O[C@@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a211h-1a_1-4]/1/ |
| InChI | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4+,5+/m0/s1 |
| InChIKey | HMFHBZSHGGEWLO-QMKXCQHVSA-N |
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). fundamental metabolite Any metabolite produced by all living cells. fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-L-arabinofuranose (CHEBI:28772) has role allergen (CHEBI:50904) |
| α-L-arabinofuranose (CHEBI:28772) is a L-arabinofuranose (CHEBI:6178) |
| Incoming Relation(s) |
| (+)-taxifolin 3-O-α-L-arabinofuranoside (CHEBI:75740) has functional parent α-L-arabinofuranose (CHEBI:28772) |
| β-D-Galp-(1→3)-α-L-Araf (CHEBI:154376) has functional parent α-L-arabinofuranose (CHEBI:28772) |
| IUPAC Name |
|---|
| α-L-arabinofuranose |
| Synonyms | Source |
|---|---|
| ALPHA-L-ARABINOFURANOSE | PDBeChem |
| alpha-L-Arabinose | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| α-L-arabinofuranose | UniProt |