EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O5 |
| Net Charge | 0 |
| Average Mass | 294.307 |
| Monoisotopic Mass | 294.12157 |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C14H18N2O5/c1-21-14(20)11(7-9-5-3-2-4-6-9)16-13(19)10(15)8-12(17)18/h2-6,10-11H,7-8,15H2,1H3,(H,16,19)(H,17,18)/t10-,11-/m0/s1 |
| InChIKey | IAOZJIPTCAWIRG-QWRGUYRKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. sweetening agent Substance that sweeten food, beverages, medications, etc. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. EC 3.1.3.1 (alkaline phosphatase) inhibitor An EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor that interferes with the action of alkaline phosphatase (EC 3.1.3.1). apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. sweetening agent Substance that sweeten food, beverages, medications, etc. |
| Applications: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. sweetening agent Substance that sweeten food, beverages, medications, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspartame (CHEBI:2877) has functional parent L-aspartic acid (CHEBI:17053) |
| aspartame (CHEBI:2877) has functional parent methyl L-phenylalaninate (CHEBI:49339) |
| aspartame (CHEBI:2877) has role apoptosis inhibitor (CHEBI:68494) |
| aspartame (CHEBI:2877) has role EC 3.1.3.1 (alkaline phosphatase) inhibitor (CHEBI:63332) |
| aspartame (CHEBI:2877) has role environmental contaminant (CHEBI:78298) |
| aspartame (CHEBI:2877) has role micronutrient (CHEBI:27027) |
| aspartame (CHEBI:2877) has role nutraceutical (CHEBI:50733) |
| aspartame (CHEBI:2877) has role sweetening agent (CHEBI:50505) |
| aspartame (CHEBI:2877) has role xenobiotic (CHEBI:35703) |
| aspartame (CHEBI:2877) is a carboxylic acid (CHEBI:33575) |
| aspartame (CHEBI:2877) is a dipeptide (CHEBI:46761) |
| aspartame (CHEBI:2877) is a methyl ester (CHEBI:25248) |
| aspartame (CHEBI:2877) is tautomer of aspartame zwitterion (CHEBI:195544) |
| Incoming Relation(s) |
| aspartame zwitterion (CHEBI:195544) is tautomer of aspartame (CHEBI:2877) |
| IUPAC Name |
|---|
| methyl L-α-aspartyl-L-phenylalaninate |
| INNs | Source |
|---|---|
| aspartam | WHO MedNet |
| aspartamo | WHO MedNet |
| aspartamum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-methyl N-L-α-aspartyl-L-phenylalanate | ChemIDplus |
| 3-Amino-N-(α-carboxyphenethyl)succinamic acid N-methyl ester | ChemIDplus |
| 3-Amino-N-(α-methoxycarbonylphenethyl) succinamic acid | ChemIDplus |
| Aspartame | KEGG COMPOUND |
| Aspartylphenylalanine methyl ester | ChemIDplus |
| Asp-phe-ome | ChemIDplus |
| Brand Names | Source |
|---|---|
| AminoSweet | ChEBI |
| Sanecta | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2223850 | Reaxys |
| CAS:22839-47-0 | ChemIDplus |
| CAS:22839-47-0 | KEGG COMPOUND |
| Citations |
|---|