EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2877 - aspartame
| Formula | C14H18N2O5 |
| Net Charge | 0 |
| Average Mass | 294.307 |
| Monoisotopic Mass | 294.12157 |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C14H18N2O5/c1-21-14(20)11(7-9-5-3-2-4-6-9)16-13(19)10(15)8-12(17)18/h2-6,10-11H,7-8,15H2,1H3,(H,16,19)(H,17,18)/t10-,11-/m0/s1 |
| InChIKey | IAOZJIPTCAWIRG-QWRGUYRKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | sweetening agent Substance that sweeten food, beverages, medications, etc. environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. EC 3.1.3.1 (alkaline phosphatase) inhibitor An EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor that interferes with the action of alkaline phosphatase (EC 3.1.3.1). sweetening agent Substance that sweeten food, beverages, medications, etc. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. sweetening agent Substance that sweeten food, beverages, medications, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspartame (CHEBI:2877) has functional parent L-aspartic acid (CHEBI:17053) |
| aspartame (CHEBI:2877) has functional parent methyl L-phenylalaninate (CHEBI:49339) |
| aspartame (CHEBI:2877) has role apoptosis inhibitor (CHEBI:68494) |
| aspartame (CHEBI:2877) has role EC 3.1.3.1 (alkaline phosphatase) inhibitor (CHEBI:63332) |
| aspartame (CHEBI:2877) has role environmental contaminant (CHEBI:78298) |
| aspartame (CHEBI:2877) has role micronutrient (CHEBI:27027) |
| aspartame (CHEBI:2877) has role nutraceutical (CHEBI:50733) |
| aspartame (CHEBI:2877) has role sweetening agent (CHEBI:50505) |
| aspartame (CHEBI:2877) has role xenobiotic (CHEBI:35703) |
| aspartame (CHEBI:2877) is a carboxylic acid (CHEBI:33575) |
| aspartame (CHEBI:2877) is a dipeptide (CHEBI:46761) |
| aspartame (CHEBI:2877) is a methyl ester (CHEBI:25248) |
| aspartame (CHEBI:2877) is tautomer of aspartame zwitterion (CHEBI:195544) |
| Incoming Relation(s) |
| aspartame zwitterion (CHEBI:195544) is tautomer of aspartame (CHEBI:2877) |
| IUPAC Name |
|---|
| methyl L-α-aspartyl-L-phenylalaninate |
| INNs | Source |
|---|---|
| aspartam | WHO MedNet |
| aspartamo | WHO MedNet |
| aspartamum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-methyl N-L-α-aspartyl-L-phenylalanate | ChemIDplus |
| 3-Amino-N-(α-carboxyphenethyl)succinamic acid N-methyl ester | ChemIDplus |
| 3-Amino-N-(α-methoxycarbonylphenethyl) succinamic acid | ChemIDplus |
| Aspartame | KEGG COMPOUND |
| Aspartylphenylalanine methyl ester | ChemIDplus |
| Asp-phe-ome | ChemIDplus |
| Brand Names | Source |
|---|---|
| AminoSweet | ChEBI |
| Sanecta | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2223850 | Reaxys |
| CAS:22839-47-0 | ChemIDplus |
| CAS:22839-47-0 | KEGG COMPOUND |
| Citations |
|---|