EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H44N4O16 |
| Net Charge | 0 |
| Average Mass | 836.804 |
| Monoisotopic Mass | 836.27523 |
| SMILES | O=C(O)CCc1c2nc(c1CC(=O)O)Cc1nc(c(CC(=O)O)c1CCC(=O)O)Cc1nc(c(CC(=O)O)c1CCC(=O)O)Cc1nc(c(CC(=O)O)c1CCC(=O)O)C2 |
| InChI | InChI=1S/C40H44N4O16/c45-33(46)5-1-17-21(9-37(53)54)29-14-26-19(3-7-35(49)50)23(11-39(57)58)31(43-26)16-28-20(4-8-36(51)52)24(12-40(59)60)32(44-28)15-27-18(2-6-34(47)48)22(10-38(55)56)30(42-27)13-25(17)41-29/h41-44H,1-16H2,(H,45,46)(H,47,48)(H,49,50)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60) |
| InChIKey | QTTNOSKSLATGQB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| uroporphyrinogen I (CHEBI:28766) has role human metabolite (CHEBI:77746) |
| uroporphyrinogen I (CHEBI:28766) has role mouse metabolite (CHEBI:75771) |
| uroporphyrinogen I (CHEBI:28766) is a uroporphyrinogen (CHEBI:27258) |
| uroporphyrinogen I (CHEBI:28766) is conjugate acid of uroporphyrinogen I(8−) (CHEBI:62626) |
| Incoming Relation(s) |
| uroporphyrinogen I(8−) (CHEBI:62626) is conjugate base of uroporphyrinogen I (CHEBI:28766) |
| IUPAC Name |
|---|
| 3,8,13,18-tetrakis(carboxymethyl)-5,10,15,20,22,24-hexahydroporphyrin-2,7,12,17-tetrapropanoic acid |
| Synonyms | Source |
|---|---|
| 3,8,13,18-tetrakis(carboxymethyl)-5,10,15,20,22,24-hexahydroporphyrin-2,7,12,17-tetrapropionic acid | JCBN |
| uro'gen I | ChEBI |
| uroporphyrinogen-I | MetaCyc |
| Uroporphyrinogen I | KEGG COMPOUND |
| Citations |
|---|