EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O4 |
| Net Charge | 0 |
| Average Mass | 182.175 |
| Monoisotopic Mass | 182.05791 |
| SMILES | COc1cc(O)c(C(C)=O)c(O)c1 |
| InChI | InChI=1S/C9H10O4/c1-5(10)9-7(11)3-6(13-2)4-8(9)12/h3-4,11-12H,1-2H3 |
| InChIKey | GKSGTWUNURZTKD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sanguisorba minor (ncbitaxon:137456) | Root (BTO:0001188) | DOI (10.1016/S0031-9422(00)94758-7) |
| Roles Classification |
|---|
| Biological Roles: | phytoalexin A toxin made by a plant that acts against an organism attacking it. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2',6'-dihydroxy-4'-methoxyacetophenone (CHEBI:28758) has functional parent 2',4',6'-trihydroxyacetophenone (CHEBI:64344) |
| 2',6'-dihydroxy-4'-methoxyacetophenone (CHEBI:28758) has role phytoalexin (CHEBI:26115) |
| 2',6'-dihydroxy-4'-methoxyacetophenone (CHEBI:28758) has role plant metabolite (CHEBI:76924) |
| 2',6'-dihydroxy-4'-methoxyacetophenone (CHEBI:28758) is a dihydroxyacetophenone (CHEBI:23776) |
| 2',6'-dihydroxy-4'-methoxyacetophenone (CHEBI:28758) is a monomethoxybenzene (CHEBI:25235) |
| 2',6'-dihydroxy-4'-methoxyacetophenone (CHEBI:28758) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 1-(2,6-dihydroxy-4-methoxyphenyl)ethanone |
| Synonyms | Source |
|---|---|
| 1-(2,6-dihydroxy-4-methoxyphenyl)ethan-1-one | IUPAC |
| 2,6-dihydroxy-4-methoxyacetophenone | NIST Chemistry WebBook |
| 2',6'-dihydroxy-4'-methoxyacetophenone | KEGG COMPOUND |
| 2-acetyl-5-methoxyresorcinol | ChEBI |
| 4-O-methylphloracetophenone | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C00002694 | KNApSAcK |
| C10680 | KEGG COMPOUND |
| FDB000817 | FooDB |
| HMDB0029646 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:7507-89-3 | NIST Chemistry WebBook |
| Citations |
|---|