EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3Cl3O |
| Net Charge | 0 |
| Average Mass | 197.448 |
| Monoisotopic Mass | 195.92495 |
| SMILES | Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C6H3Cl3O/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H |
| InChIKey | LINPIYWFGCPVIE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,6-trichlorophenol (CHEBI:28755) has role carcinogenic agent (CHEBI:50903) |
| 2,4,6-trichlorophenol (CHEBI:28755) is a trichlorophenol (CHEBI:27102) |
| 2,4,6-trichlorophenol (CHEBI:28755) is conjugate acid of 2,4,6-trichlorophenolate (CHEBI:140426) |
| Incoming Relation(s) |
| 2,4,6-trichlorophenolate (CHEBI:140426) is conjugate base of 2,4,6-trichlorophenol (CHEBI:28755) |
| IUPAC Name |
|---|
| 2,4,6-trichlorophenol |
| Synonyms | Source |
|---|---|
| 1,3,5-Trichloro-2-hydroxybenzene | NIST Chemistry WebBook |
| 2,4,6-TCP | UM-BBD |
| 2,4,6-Trichlorophenol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2,4,6-Trichlorophenol | Wikipedia |
| c0330 | UM-BBD |
| C07098 | KEGG COMPOUND |
| T6C | PDBeChem |
| TRICHLOROPHENOL | MetaCyc |
| Citations |
|---|