EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H56O4 |
| Net Charge | 0 |
| Average Mass | 576.862 |
| Monoisotopic Mass | 576.41786 |
| SMILES | COC1=C(O)C(=O)C(C)=C(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C1=O |
| InChI | InChI=1S/C38H56O4/c1-27(2)15-10-16-28(3)17-11-18-29(4)19-12-20-30(5)21-13-22-31(6)23-14-24-32(7)25-26-34-33(8)35(39)37(41)38(42-9)36(34)40/h15,17,19,21,23,25,41H,10-14,16,18,20,22,24,26H2,1-9H3/b28-17+,29-19+,30-21+,31-23+,32-25+ |
| InChIKey | YPBJTTYNKXYYKL-HGJBZHBGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-demethylubiquinone-6 (CHEBI:28753) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 3-demethylubiquinone-6 (CHEBI:28753) has role mouse metabolite (CHEBI:75771) |
| 3-demethylubiquinone-6 (CHEBI:28753) is a monohydroxy-1,4-benzoquinones (CHEBI:67273) |
| 3-demethylubiquinone-6 (CHEBI:28753) is a polyprenylbenzoquinone (CHEBI:35795) |
| 3-demethylubiquinone-6 (CHEBI:28753) is conjugate acid of 3-demethylubiquinone-6(1−) (CHEBI:231821) |
| Incoming Relation(s) |
| 3-demethylubiquinone-6(1−) (CHEBI:231821) is conjugate base of 3-demethylubiquinone-6 (CHEBI:28753) |
| IUPAC Names |
|---|
| 2-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-yl]-5-hydroxy-6-methoxy-3-methyl-1,4-benzoquinone |
| 2-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-yl]-5-hydroxy-6-methoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| Synonyms | Source |
|---|---|
| 2-Hexaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone | KEGG COMPOUND |
| 2-hexaprenyl-5-hydroxy-6-methoxy-3-methyl-1,4-benzoquinone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05805 | KEGG COMPOUND |