EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10O2 |
| Net Charge | 0 |
| Average Mass | 198.221 |
| Monoisotopic Mass | 198.06808 |
| SMILES | Oc1ccc2c(c1O)-c1ccccc1C2 |
| InChI | InChI=1S/C13H10O2/c14-11-6-5-9-7-8-3-1-2-4-10(8)12(9)13(11)15/h1-6,14-15H,7H2 |
| InChIKey | OOGFPMKHMOAMMY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dihydroxyfluorene (CHEBI:28752) has role mouse metabolite (CHEBI:75771) |
| 3,4-dihydroxyfluorene (CHEBI:28752) is a hydroxyfluorenes (CHEBI:24699) |
| IUPAC Name |
|---|
| 9H-fluorene-3,4-diol |
| Manual Xrefs | Databases |
|---|---|
| C07717 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2107547 | Reaxys |
| CAS:42523-20-6 | KEGG COMPOUND |