EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11N |
| Net Charge | 0 |
| Average Mass | 121.183 |
| Monoisotopic Mass | 121.08915 |
| SMILES | Cc1cccc(C)c1N |
| InChI | InChI=1S/C8H11N/c1-6-4-3-5-7(2)8(6)9/h3-5H,9H2,1-2H3 |
| InChIKey | UFFBMTHBGFGIHF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dimethylaniline (CHEBI:28738) has role carcinogenic agent (CHEBI:50903) |
| 2,6-dimethylaniline (CHEBI:28738) has role drug metabolite (CHEBI:49103) |
| 2,6-dimethylaniline (CHEBI:28738) is a dimethylaniline (CHEBI:23806) |
| 2,6-dimethylaniline (CHEBI:28738) is a primary arylamine (CHEBI:50471) |
| Incoming Relation(s) |
| N-(2,6-dimethylphenyl)-N2-(3,5-dimethylphenyl)glycinamide (CHEBI:75364) has functional parent 2,6-dimethylaniline (CHEBI:28738) |
| IUPAC Name |
|---|
| 2,6-dimethylaniline |
| Synonyms | Source |
|---|---|
| 2,6-Dimethylaniline | KEGG COMPOUND |
| 2,6-DMA | KEGG COMPOUND |
| 2,6-xylidine | ChemIDplus |
| 1-amino-2,6-dimethylbenzene | ChemIDplus |
| vic-m-xylidine | ChEBI |
| 2,6-dimethylbenzenamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11004 | KEGG COMPOUND |
| HMDB0060677 | HMDB |
| 2,6-Xylidine | Wikipedia |
| Citations |
|---|