EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28731 - gibberellin A19
| Formula | C20H26O6 |
| Net Charge | 0 |
| Average Mass | 362.422 |
| Monoisotopic Mass | 362.17294 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]2(C=O)CCC[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C20H26O6/c1-11-8-19-9-20(11,26)7-4-12(19)18(10-21)6-3-5-17(2,16(24)25)14(18)13(19)15(22)23/h10,12-14,26H,1,3-9H2,2H3,(H,22,23)(H,24,25)/t12-,13+,14+,17+,18+,19-,20-/m0/s1 |
| InChIKey | VNCQCPQAMDQEBY-YTJHIPEWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A19 (CHEBI:28731) has role plant metabolite (CHEBI:76924) |
| gibberellin A19 (CHEBI:28731) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A19 (CHEBI:28731) is a dicarboxylic acid (CHEBI:35692) |
| gibberellin A19 (CHEBI:28731) is conjugate acid of gibberellin A19(2−) (CHEBI:58587) |
| Incoming Relation(s) |
| gibberellin A19(2−) (CHEBI:58587) is conjugate base of gibberellin A19 (CHEBI:28731) |
| IUPAC Names |
|---|
| (1S,2S,3S,4R,8R,9R,12S)-8-formyl-12-hydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid |
| 4a-formyl-7α-hydroxy-1-methyl-8-methylidene-4aα,4bβ-gibbane-1α,10β-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| GA19 | ChEBI |
| Gibberellin 19 | KEGG COMPOUND |
| Gibberellin 19 | KEGG COMPOUND |
| Gibberellin A19 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000019 | KNApSAcK |
| C02034 | KEGG COMPOUND |
| HMDB0036896 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2784710 | Reaxys |
| CAS:6980-44-5 | KEGG COMPOUND |
| CAS:6980-44-5 | ChemIDplus |
| Citations |
|---|