EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19N5O3 |
| Net Charge | 0 |
| Average Mass | 245.283 |
| Monoisotopic Mass | 245.14879 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)CCN)C(=O)O |
| InChI | InChI=1S/C9H19N5O3/c10-4-3-7(15)14-6(8(16)17)2-1-5-13-9(11)12/h6H,1-5,10H2,(H,14,15)(H,16,17)(H4,11,12,13)/t6-/m0/s1 |
| InChIKey | DLRGFJGVZXSSTP-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-alanyl-L-arginine (CHEBI:28712) is a dipeptide (CHEBI:46761) |
| β-alanyl-L-arginine (CHEBI:28712) is conjugate base of β-alanyl-L-argininium (CHEBI:143157) |
| Incoming Relation(s) |
| β-alanyl-L-argininium (CHEBI:143157) is conjugate acid of β-alanyl-L-arginine (CHEBI:28712) |
| IUPAC Name |
|---|
| β-alanyl-L-arginine |
| Synonyms | Source |
|---|---|
| (2S)-5-{[amino(imino)methyl]amino}-2-[(3-aminopropanoyl)amino]pentanoic acid | ChEBI |
| beta-Alanyl-L-arginine | KEGG COMPOUND |
| βAla-Arg | JCBN |
| Manual Xrefs | Databases |
|---|---|
| C05340 | KEGG COMPOUND |