EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32O14 |
| Net Charge | 0 |
| Average Mass | 580.539 |
| Monoisotopic Mass | 580.17921 |
| SMILES | C[C@@H]1O[C@@H](OC[C@H]2O[C@@H](Oc3cc(O)c4c(c3)O[C@H](c3ccc(O)cc3)CC4=O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H32O14/c1-10-20(31)22(33)24(35)26(38-10)37-9-18-21(32)23(34)25(36)27(41-18)39-13-6-14(29)19-15(30)8-16(40-17(19)7-13)11-2-4-12(28)5-3-11/h2-7,10,16,18,20-29,31-36H,8-9H2,1H3/t10-,16-,18+,20-,21+,22+,23-,24+,25+,26+,27+/m0/s1 |
| InChIKey | HXTFHSYLYXVTHC-AJHDJQPGSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| narirutin (CHEBI:28705) has functional parent (S)-naringenin (CHEBI:17846) |
| narirutin (CHEBI:28705) has role anti-inflammatory agent (CHEBI:67079) |
| narirutin (CHEBI:28705) has role antioxidant (CHEBI:22586) |
| narirutin (CHEBI:28705) has role metabolite (CHEBI:25212) |
| narirutin (CHEBI:28705) is a (2S)-flavan-4-one (CHEBI:140377) |
| narirutin (CHEBI:28705) is a 4'-hydroxyflavanones (CHEBI:140331) |
| narirutin (CHEBI:28705) is a dihydroxyflavanone (CHEBI:38749) |
| narirutin (CHEBI:28705) is a disaccharide derivative (CHEBI:63353) |
| narirutin (CHEBI:28705) is a rutinoside (CHEBI:26587) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-3,4-dihydro-2H-chromen-7-yl 6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Narirutin | KEGG COMPOUND |
| Naringenin 7-O-rutinoside | KEGG COMPOUND |
| Isonaringenin | ChemIDplus |
| Isonaringin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C09793 | KEGG COMPOUND |
| CPD-7059 | MetaCyc |
| HMDB0033740 | HMDB |
| LMPK12140236 | LIPID MAPS |
| C00000984 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1361182 | Reaxys |
| CAS:14259-46-2 | KEGG COMPOUND |
| CAS:14259-46-2 | ChemIDplus |
| Citations |
|---|