EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O3 |
| Net Charge | 0 |
| Average Mass | 242.274 |
| Monoisotopic Mass | 242.09429 |
| SMILES | COc1cc(O)c2c(c1)CCc1cc(O)ccc1-2 |
| InChI | InChI=1S/C15H14O3/c1-18-12-7-10-3-2-9-6-11(16)4-5-13(9)15(10)14(17)8-12/h4-8,16-17H,2-3H2,1H3 |
| InChIKey | RDKDIPDDUFMMMT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methoxy-9,10-dihydrophenanthrene-2,5-diol (CHEBI:28678) is a dihydrophenanthrene (CHEBI:23759) |
| IUPAC Name |
|---|
| 7-methoxy-9,10-dihydrophenanthrene-2,5-diol |
| Synonym | Source |
|---|---|
| 4,7-Dihydroxy-2-methoxy-9,10-dihydrophenanthrene | KEGG COMPOUND |