EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O |
| Net Charge | 0 |
| Average Mass | 148.205 |
| Monoisotopic Mass | 148.08882 |
| SMILES | [H]C(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C10H12O/c1-8(2)10-5-3-9(7-11)4-6-10/h3-8H,1-2H3 |
| InChIKey | WTWBUQJHJGUZCY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cuminaldehyde (CHEBI:28671) has parent hydride cumene (CHEBI:34656) |
| cuminaldehyde (CHEBI:28671) has role insecticide (CHEBI:24852) |
| cuminaldehyde (CHEBI:28671) has role plant metabolite (CHEBI:76924) |
| cuminaldehyde (CHEBI:28671) has role volatile oil component (CHEBI:27311) |
| cuminaldehyde (CHEBI:28671) is a benzaldehydes (CHEBI:22698) |
| IUPAC Name |
|---|
| 4-(propan-2-yl)benzaldehyde |
| Synonyms | Source |
|---|---|
| p-Cumic aldehyde | KEGG COMPOUND |
| Cumic aldehyde | ChemIDplus |
| p-Isopropylbenzenecarboxaldehyde | ChemIDplus |
| p-Isopropylbenzaldehyde | ChemIDplus |
| 4-Isopropylbenzaldehyde | ChemIDplus |
| Cuminyl aldehyde | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 4-isopropylbenzaldehyde | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C06577 | KEGG COMPOUND |
| Cuminaldehyde | Wikipedia |
| HMDB0002214 | HMDB |
| CPD-1003 | MetaCyc |
| C00003039 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:636547 | Reaxys |
| CAS:122-03-2 | KEGG COMPOUND |
| CAS:122-03-2 | ChemIDplus |
| Citations |
|---|