EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H42O10 |
| Net Charge | 0 |
| Average Mass | 574.667 |
| Monoisotopic Mass | 574.27780 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@]3(O)CC[C@]4([H])C3=CC(=O)OC3)[C@@]1(C=O)C[C@@]1([H])O[C@@]3(O)[C@@H](OC(C)=O)C[C@@H](C)O[C@@]3([H])O[C@]1([H])C2 |
| InChI | InChI=1S/C31H42O10/c1-16-10-25(39-17(2)33)31(36)27(38-16)40-23-12-19-4-5-22-21(29(19,15-32)13-24(23)41-31)6-8-28(3)20(7-9-30(22,28)35)18-11-26(34)37-14-18/h11,15-16,19-25,27,35-36H,4-10,12-14H2,1-3H3/t16-,19+,20-,21+,22-,23-,24-,25+,27+,28-,29-,30+,31+/m1/s1 |
| InChIKey | OXKMZIABKYHLAR-SVDYBJNLSA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asclepin (CHEBI:2867) is a cardenolide glycoside (CHEBI:38092) |
| Synonym | Source |
|---|---|
| Asclepin | KEGG COMPOUND |