EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O |
| Net Charge | 0 |
| Average Mass | 194.233 |
| Monoisotopic Mass | 194.07316 |
| SMILES | C1=CC2OC2c2ccc3ccccc3c21 |
| InChI | InChI=1S/C14H10O/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-14(12)15-13/h1-8,13-14H |
| InChIKey | ALTXUIJFJAHUPS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-epoxy-1,2-dihydrophenanthrene (CHEBI:28668) is a phenanthrene oxide (CHEBI:25959) |
| Incoming Relation(s) |
| (1R,2S)-1,2-epoxy-1,2-dihydrophenanthrene (CHEBI:37095) is a 1,2-epoxy-1,2-dihydrophenanthrene (CHEBI:28668) |
| (1S,2R)-1,2-epoxy-1,2-dihydrophenanthrene (CHEBI:37094) is a 1,2-epoxy-1,2-dihydrophenanthrene (CHEBI:28668) |
| IUPAC Name |
|---|
| 1a,9a-dihydrophenanthro[1,2-b]oxirene |
| Synonyms | Source |
|---|---|
| 1,2-epoxy-1,2-dihydro-phenanthrene | UM-BBD |
| 1a,9a-dihydro-1-oxa-cyclopropaphenanthrene | UM-BBD |
| phenanthrene 1,2-oxide | ChEBI |
| Phenanthrene-1,2-oxide | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1344519 | Beilstein |
| CAS:39834-44-1 | ChemIDplus |
| CAS:66226-25-3 | KEGG COMPOUND |