EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7N5O |
| Net Charge | 0 |
| Average Mass | 165.156 |
| Monoisotopic Mass | 165.06506 |
| SMILES | Cn1cnc2nc(N)nc(=O)c21 |
| InChI | InChI=1S/C6H7N5O/c1-11-2-8-4-3(11)5(12)10-6(7)9-4/h2H,1H3,(H3,7,9,10,12) |
| InChIKey | FZWGECJQACGGTI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-7-methyl-1,7-dihydro-6H-purin-6-one (CHEBI:28664) is a 7-methylguanine (CHEBI:2274) |
| 2-amino-7-methyl-1,7-dihydro-6H-purin-6-one (CHEBI:28664) is tautomer of 2-amino-7-methyl-7H-purin-6-ol (CHEBI:46897) |
| 2-amino-7-methyl-1,7-dihydro-6H-purin-6-one (CHEBI:28664) is tautomer of 2-imino-7-methyl-1,2,3,7-tetrahydro-6H-purin-6-one (CHEBI:46894) |
| Incoming Relation(s) |
| 2-amino-7-methyl-7H-purin-6-ol (CHEBI:46897) is tautomer of 2-amino-7-methyl-1,7-dihydro-6H-purin-6-one (CHEBI:28664) |
| 2-imino-7-methyl-1,2,3,7-tetrahydro-6H-purin-6-one (CHEBI:46894) is tautomer of 2-amino-7-methyl-1,7-dihydro-6H-purin-6-one (CHEBI:28664) |
| IUPAC Name |
|---|
| 2-amino-7-methyl-1,7-dihydro-6H-purin-6-one |
| Synonyms | Source |
|---|---|
| 2-amino-1,7-dihydro-7-methyl-6H-purin-6-one | ChemIDplus |
| N7-methylguanine | NIST Chemistry WebBook |
| 2-amino-7-methylhypoxanthine | ChemIDplus |
| 7-methylguanine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| N7-methylguanine | UniProt |