EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | CC1=CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h4,8-9H,5-6H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | GRWFGVWFFZKLTI-IUCAKERBSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-α-pinene (CHEBI:28660) is a α-pinene (CHEBI:36740) |
| (−)-α-pinene (CHEBI:28660) is enantiomer of (+)-α-pinene (CHEBI:28261) |
| Incoming Relation(s) |
| (+)-α-pinene (CHEBI:28261) is enantiomer of (−)-α-pinene (CHEBI:28660) |
| IUPAC Names |
|---|
| (1S,5S)-2,6,6-trimethylbicyclo[3.1.1]hept-2-ene |
| (1S,5S)-pin-2-ene |
| Synonyms | Source |
|---|---|
| (-)-alpha-Pinene | KEGG COMPOUND |
| (-)-alpha-pinene | ChEBI |
| (1S)-2,6,6-trimethylbicyclo[3.1.1]hept-2-ene | NIST Chemistry WebBook |
| (1S,5S)-2,6,6-Trimethylbicyclo[3.1.1]hept-2-ene | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (1S,5S)-α-pinene | UniProt |