EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7N |
| Net Charge | 0 |
| Average Mass | 69.107 |
| Monoisotopic Mass | 69.05785 |
| SMILES | CC(C)C#N |
| InChI | InChI=1S/C4H7N/c1-4(2)3-5/h4H,1-2H3 |
| InChIKey | LRDFRRGEGBBSRN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| Application: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isobutyronitrile (CHEBI:28638) has role polar aprotic solvent (CHEBI:48358) |
| isobutyronitrile (CHEBI:28638) is a aliphatic nitrile (CHEBI:80291) |
| isobutyronitrile (CHEBI:28638) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| 2-methylpropanenitrile |
| Synonyms | Source |
|---|---|
| dimethylacetonitrile | ChemIDplus |
| 2-methylpropionitrile | ChemIDplus |
| 1-cyano-1-methylethane | ChemIDplus |
| isopropylnitrile | ChemIDplus |
| α-methylpropanenitrile | ChemIDplus |
| 2-cyanopropane | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-methylpropanenitrile | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02420 | KEGG COMPOUND |
| Isopropyl_cyanide | Wikipedia |
| Citations |
|---|