EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4Cl2 |
| Net Charge | 0 |
| Average Mass | 147.004 |
| Monoisotopic Mass | 145.96901 |
| SMILES | Clc1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H4Cl2/c7-5-1-2-6(8)4-3-5/h1-4H |
| InChIKey | OCJBOOLMMGQPQU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,4-dichlorobenzene (CHEBI:28618) has role insecticide (CHEBI:24852) |
| 1,4-dichlorobenzene (CHEBI:28618) is a dichlorobenzene (CHEBI:23697) |
| Incoming Relation(s) |
| 2,5-dichloroaniline (CHEBI:34245) has functional parent 1,4-dichlorobenzene (CHEBI:28618) |
| IUPAC Name |
|---|
| 1,4-dichlorobenzene |
| Synonyms | Source |
|---|---|
| 1,4-Dichlorobenzene | KEGG COMPOUND |
| p-Dichlorobenzene | KEGG COMPOUND |
| p-chlorophenyl chloride | NIST Chemistry WebBook |
| paradichlorobenzene | ChemIDplus |
| Paradichlorbenzol | NIST Chemistry WebBook |
| p-Dichlorbenzol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C07092 | KEGG COMPOUND |
| c0593 | UM-BBD |
| 1,4-Dichlorobenzene | Wikipedia |
| HMDB0041971 | HMDB |
| WO2010122925 | Patent |
| Citations |
|---|