EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13NO4 |
| Net Charge | 0 |
| Average Mass | 271.272 |
| Monoisotopic Mass | 271.08446 |
| SMILES | COc1ccc(C(=O)O)c(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C15H13NO4/c1-20-11-7-8-12(15(18)19)13(9-11)16-14(17)10-5-3-2-4-6-10/h2-9H,1H3,(H,16,17)(H,18,19) |
| InChIKey | NZSBJWOTLHVBNU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-benzoyl-4-methoxyanthranilic acid (CHEBI:28609) has functional parent anthranilic acid (CHEBI:30754) |
| N-benzoyl-4-methoxyanthranilic acid (CHEBI:28609) is a benzamides (CHEBI:22702) |
| N-benzoyl-4-methoxyanthranilic acid (CHEBI:28609) is a benzoic acids (CHEBI:22723) |
| N-benzoyl-4-methoxyanthranilic acid (CHEBI:28609) is a monocarboxylic acid (CHEBI:25384) |
| N-benzoyl-4-methoxyanthranilic acid (CHEBI:28609) is conjugate acid of N-benzoyl-4-methoxyanthranilate (CHEBI:36564) |
| Incoming Relation(s) |
| N-benzoyl-4-methoxyanthranilate (CHEBI:36564) is conjugate base of N-benzoyl-4-methoxyanthranilic acid (CHEBI:28609) |
| IUPAC Name |
|---|
| 2-benzamido-4-methoxybenzoic acid |
| Synonym | Source |
|---|---|
| 2-(benzoylamino)-4-methoxybenzoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C04208 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6518079 | Reaxys |