EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H48O |
| Net Charge | 0 |
| Average Mass | 412.702 |
| Monoisotopic Mass | 412.37052 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CC/C(=C/C)C(C)C |
| InChI | InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h7,10,19-20,23-27,30H,8-9,11-18H2,1-6H3/b21-7-/t20-,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | OSELKOCHBMDKEJ-WGMIZEQOSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Bombyx mori (ncbitaxon:7091) | - | DOI (10.1007/BF01959847) | |
| Apis mellifera (ncbitaxon:7460) | - | DOI (10.1016/0022-1910(80)90136-5) | |
| Euphorbia peplus (ncbitaxon:38846) | - | DOI (10.1016/S0031-9422(00)85956-7) | |
| Gracilaria foliifera (ncbitaxon:191042) | - | Article (Alarif, Walied M.; Ayyad, Seif-Eldin. N. and Al-Lihaibi, Sultan S. Acyclic diterpenoid from the red alga Gracilaria foliifera. Rev. latinoam. quím [online]. 2010, vol.38, n.1, pp.52-57. ISSN 0370-5943.) | |
| Xestospongia testudinaria (ncbitaxon:178554) | - | DOI (10.1021/ja00009a046) | |
| Equisetum arvense (ncbitaxon:3258) | cell suspension culture (BTO:0000221) | PubMed (6529502) | |
| Gynostemma pentaphyllum (ncbitaxon:182084) | - | PubMed (2775538) | |
| Solanaceae (ncbitaxon:4070) | seed (BTO:0001226) | PubMed (595039) | |
| Sargassum thunbergii (ncbitaxon:127542) | - | PubMed (24684169) |
| Roles Classification |
|---|
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isofucosterol (CHEBI:28604) has parent hydride stigmastane (CHEBI:26773) |
| isofucosterol (CHEBI:28604) has role algal metabolite (CHEBI:84735) |
| isofucosterol (CHEBI:28604) has role animal metabolite (CHEBI:75767) |
| isofucosterol (CHEBI:28604) has role marine metabolite (CHEBI:76507) |
| isofucosterol (CHEBI:28604) has role plant metabolite (CHEBI:76924) |
| isofucosterol (CHEBI:28604) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| isofucosterol (CHEBI:28604) is a 3β-sterol (CHEBI:35348) |
| isofucosterol (CHEBI:28604) is a C29-steroid (CHEBI:188923) |
| isofucosterol (CHEBI:28604) is a phytosterols (CHEBI:26125) |
| IUPAC Name |
|---|
| (24Z)-stigmasta-5,24(28)-dien-3β-ol |
| Synonyms | Source |
|---|---|
| Δ5-avenasterol | KEGG COMPOUND |
| delta5-avenasterol | KEGG COMPOUND |
| isofucosterol | LIPID MAPS |
| (Z)-24-ethylidenecholesterol | HMDB |
| (24Z)-ethylidenecholesterol | ChemIDplus |
| 28-isofucosterol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C08821 | KEGG COMPOUND |
| C00003656 | KNApSAcK |
| CPD-4127 | MetaCyc |
| HMDB0002374 | HMDB |
| LMST01040145 | LIPID MAPS |
| FDB012493 | FooDB |
| Isofucosterol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:481-14-1 | ChemIDplus |
| CAS:18472-36-1 | ChemIDplus |
| CAS:481-14-1 | NIST Chemistry WebBook |
| Citations |
|---|