EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O3 |
| Net Charge | 0 |
| Average Mass | 298.467 |
| Monoisotopic Mass | 298.25079 |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O3/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21)/b12-9-/t17-/m1/s1 |
| InChIKey | WBHHMMIMDMUBKC-QJWNTBNXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ricinoleic acid (CHEBI:28592) is a (9Z)-12-hydroxyoctadec-9-enoic acid (CHEBI:85639) |
| ricinoleic acid (CHEBI:28592) is conjugate acid of ricinoleate (CHEBI:91295) |
| Incoming Relation(s) |
| (9Z,12R)-12-hydroxyoctadec-9-enoyl-CoA (CHEBI:140153) has functional parent ricinoleic acid (CHEBI:28592) |
| ricinoleate ester (CHEBI:26576) has functional parent ricinoleic acid (CHEBI:28592) |
| triricinolein (CHEBI:140471) has functional parent ricinoleic acid (CHEBI:28592) |
| ricinoleate (CHEBI:91295) is conjugate base of ricinoleic acid (CHEBI:28592) |
| IUPAC Name |
|---|
| (9Z,12R)-12-hydroxyoctadec-9-enoic acid |
| Synonyms | Source |
|---|---|
| 12-Hydroxy-9-octadecenoic acid | KEGG COMPOUND |
| 12-Hydroxy-cis-9-octadecenoic acid | KEGG COMPOUND |
| 12-hydroxyoleic acid | ChemIDplus |
| 12-OH 9c-18:1 | ChEBI |
| (cis,R)-12-hydroxyoctadec-9-enoic acid | ChEBI |
| (Z,R)-12-hydroxyoctadec-9-enoic acid | ChEBI |
| Citations |
|---|