EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C54H90N6O18 |
| Net Charge | 0 |
| Average Mass | 1111.338 |
| Monoisotopic Mass | 1110.63116 |
| SMILES | CC(C)[C@@H]1NC(=O)[C@H](C)OC(=O)[C@@H](C(C)C)NC(=O)[C@@H](C(C)C)OC(=O)[C@H](C(C)C)NC(=O)[C@H](C)OC(=O)[C@@H](C(C)C)NC(=O)[C@@H](C(C)C)OC(=O)[C@H](C(C)C)NC(=O)[C@H](C)OC(=O)[C@@H](C(C)C)NC(=O)[C@@H](C(C)C)OC1=O |
| InChI | InChI=1S/C54H90N6O18/c1-22(2)34-49(67)73-31(19)43(61)55-38(26(9)10)53(71)77-41(29(15)16)47(65)59-36(24(5)6)51(69)75-33(21)45(63)57-39(27(11)12)54(72)78-42(30(17)18)48(66)60-35(23(3)4)50(68)74-32(20)44(62)56-37(25(7)8)52(70)76-40(28(13)14)46(64)58-34/h22-42H,1-21H3,(H,55,61)(H,56,62)(H,57,63)(H,58,64)(H,59,65)(H,60,66)/t31-,32-,33-,34+,35+,36+,37-,38-,39-,40+,41+,42+/m0/s1 |
| InChIKey | FCFNRCROJUBPLU-DNDCDFAISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces padanus (ncbitaxon:183408) | - | Article (NAT PROD SCI,2007,13,2,144) | Strain: TH 04 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | potassium ionophore Any ionophore capable of transportation of potassium ions across membranes. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valinomycin (CHEBI:28545) has role antimicrobial agent (CHEBI:33281) |
| valinomycin (CHEBI:28545) has role antiviral agent (CHEBI:22587) |
| valinomycin (CHEBI:28545) has role bacterial metabolite (CHEBI:76969) |
| valinomycin (CHEBI:28545) has role potassium ionophore (CHEBI:88227) |
| valinomycin (CHEBI:28545) is a cyclodepsipeptide (CHEBI:35213) |
| valinomycin (CHEBI:28545) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (3R,6R,9S,12S,15R,18R,21S,24S,27R,30R,33S,36S)-3,6,9,15,18,21,27,30,33-nonaisopropyl-12,24,36-trimethyl-1,7,13,19,25,31-hexaoxa-4,10,16,22,28,34-hexaazacyclohexatriacontane-2,5,8,11,14,17,20,23,26,29,32,35-dodecone |
| Synonyms | Source |
|---|---|
| Cyclic(D-alpha-hydroxyisovaleryl-D-valyl-L-lactoyl-L-valyl-D-alpha-hydroxyisovaleryl-D-valyl-L-lactoyl-L-valyl-D-alpha-hydroxyisovaleryl-D-valyl-L-lactoyl-L-valyl) | ChemIDplus |
| cyclo[-D-O-Val-D-Val-L-O-Ala-L-Val]3 | ChEBI |
| Valinomycin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06684 | KEGG COMPOUND |
| Valinomycin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:78657 | Reaxys |
| CAS:2001-95-8 | ChemIDplus |
| CAS:2001-95-8 | KEGG COMPOUND |
| Citations |
|---|