EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48O3 |
| Net Charge | 0 |
| Average Mass | 420.678 |
| Monoisotopic Mass | 420.36035 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCCC(C)CO)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H48O3/c1-17(16-28)6-5-7-18(2)21-8-9-22-25-23(11-13-27(21,22)4)26(3)12-10-20(29)14-19(26)15-24(25)30/h17-25,28-30H,5-16H2,1-4H3/t17?,18-,19+,20-,21-,22+,23+,24-,25+,26+,27-/m1/s1 |
| InChIKey | OQIJRBFRXGIHMI-UGMUFZQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). bile acid metabolite Metabolites of bile acids, four-ringed steroid acids formed along the cholesterol degradation pathway. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5β-cholestane-3α,7α,26-triol (CHEBI:28540) has parent hydride 5β-cholestane (CHEBI:35517) |
| 5β-cholestane-3α,7α,26-triol (CHEBI:28540) has role bile acid metabolite (CHEBI:48887) |
| 5β-cholestane-3α,7α,26-triol (CHEBI:28540) has role human metabolite (CHEBI:77746) |
| 5β-cholestane-3α,7α,26-triol (CHEBI:28540) has role mouse metabolite (CHEBI:75771) |
| 5β-cholestane-3α,7α,26-triol (CHEBI:28540) is a 26-hydroxy steroid (CHEBI:36852) |
| 5β-cholestane-3α,7α,26-triol (CHEBI:28540) is a 3α-hydroxy steroid (CHEBI:36835) |
| 5β-cholestane-3α,7α,26-triol (CHEBI:28540) is a 7α-hydroxy steroid (CHEBI:36843) |
| IUPAC Name |
|---|
| 5β-cholestane-3α,7α,26-triol |
| Synonyms | Source |
|---|---|
| 3alpha,7alpha,26-trihydroxy-5beta-cholestane | ChEBI |
| 3alpha,7alpha,26-Trihydroxy-5beta-cholestane | KEGG COMPOUND |
| 5beta-cholestane-3alpha,7alpha,26-triol | ChEBI |
| 5beta-Cholestane-3alpha,7alpha,26-triol | KEGG COMPOUND |
| 5β-cholestan-3α,7α,26-triol | ChEBI |
| Cholestane-3,7,26-triol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C05444 | KEGG COMPOUND |
| C05444 | KEGG COMPOUND |
| LMST04030020 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:15313-69-6 | ChemIDplus |