EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | C=C1CC[C@H]2C(=C)C(=O)O[C@@H]2/C=C(\C)CC[C@H]1O |
| InChI | InChI=1S/C15H20O3/c1-9-4-7-13(16)10(2)5-6-12-11(3)15(17)18-14(12)8-9/h8,12-14,16H,2-7H2,1H3/b9-8+/t12-,13+,14+/m0/s1 |
| InChIKey | JNHKVMWTQCZYHK-CVZWCJCVSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| artemorin (CHEBI:2853) has role allergen (CHEBI:50904) |
| artemorin (CHEBI:2853) has role metabolite (CHEBI:25212) |
| artemorin (CHEBI:2853) is a germacranolide (CHEBI:73011) |
| IUPAC Name |
|---|
| (7R,10E)-7-hydroxy-10-methyl-3,6-bis(methylidene)-3a,4,5,6,7,8,9,11a-octahydrocyclodeca[b]furan-2(3H)-one |
| Synonym | Source |
|---|---|
| Artemorin | KEGG COMPOUND |
| Citations |
|---|