EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H24O12 |
| Net Charge | 0 |
| Average Mass | 588.521 |
| Monoisotopic Mass | 588.12678 |
| SMILES | COc1ccc([C@H]2Oc3c(c(O)cc(O)c3[C@H]3C(=O)c4c(O)cc(O)cc4O[C@@H]3c3ccc(O)cc3)C(=O)[C@@H]2O)cc1O |
| InChI | InChI=1S/C31H24O12/c1-41-20-7-4-13(8-16(20)34)30-28(40)27(39)24-19(37)11-18(36)23(31(24)43-30)25-26(38)22-17(35)9-15(33)10-21(22)42-29(25)12-2-5-14(32)6-3-12/h2-11,25,28-30,32-37,40H,1H3/t25-,28-,29+,30+/m0/s1 |
| InChIKey | GJWXCPDVDRIBKP-CNTBMXMRSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kolaflavanone (CHEBI:28521) has role hepatoprotective agent (CHEBI:62868) |
| kolaflavanone (CHEBI:28521) has role plant metabolite (CHEBI:76924) |
| kolaflavanone (CHEBI:28521) is a 4'-methoxyflavanones (CHEBI:140332) |
| kolaflavanone (CHEBI:28521) is a biflavonoid (CHEBI:50128) |
| kolaflavanone (CHEBI:28521) is a dihydroflavonols (CHEBI:48039) |
| kolaflavanone (CHEBI:28521) is a ring assembly (CHEBI:36820) |
| kolaflavanone (CHEBI:28521) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (2S,2'R,3R,3'R)-3',5,5',7,7'-pentahydroxy-2'-(3-hydroxy-4-methoxyphenyl)-2-(4-hydroxyphenyl)-2,2',3,3'-tetrahydro-4H,4'H-3,8'-bichromene-4,4'-dione |
| Synonyms | Source |
|---|---|
| Kolaflavanone | KEGG COMPOUND |
| (2S,2'R,3R,3'R)-2,2',3,3'-tetrahydro-3',5,5',7,7'-pentahydroxy-2'-(3-hydroxy-4-methoxyphenyl)-2-(4-hydroxyphenyl)-(3,8'-bi-4H-1-benzopyran)-4,4'-dione | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C09761 | KEGG COMPOUND |
| LMPK12040002 | LIPID MAPS |
| C00000976 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8747215 | Reaxys |
| CAS:68705-66-8 | KEGG COMPOUND |
| CAS:68705-66-8 | ChemIDplus |
| Citations |
|---|