EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2 |
| Net Charge | 0 |
| Average Mass | 160.220 |
| Monoisotopic Mass | 160.10005 |
| SMILES | c1ccc(CC2=NCCN2)cc1 |
| InChI | InChI=1S/C10H12N2/c1-2-4-9(5-3-1)8-10-11-6-7-12-10/h1-5H,6-8H2,(H,11,12) |
| InChIKey | JIVZKJJQOZQXQB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolazoline (CHEBI:28502) has role antihypertensive agent (CHEBI:35674) |
| tolazoline (CHEBI:28502) has role vasodilator agent (CHEBI:35620) |
| tolazoline (CHEBI:28502) has role α-adrenergic antagonist (CHEBI:37890) |
| tolazoline (CHEBI:28502) is a imidazoles (CHEBI:24780) |
| IUPAC Name |
|---|
| 2-benzyl-4,5-dihydro-1H-imidazole |
| Synonyms | Source |
|---|---|
| Tolazoline | KEGG COMPOUND |
| 4,5-Dihydro-2-(phenylmethyl)-1H-imidazole | KEGG COMPOUND |
| 2-Benzyl-2-imidazoline | ChemIDplus |
| 2-Benzyl-4,5-imidazoline | ChemIDplus |
| 2-Benzylimidazoline | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C07147 | KEGG COMPOUND |
| Tolazoline | Wikipedia |
| DB00797 | DrugBank |
| HMDB0014935 | HMDB |
| D08614 | KEGG DRUG |
| LSM-3020 | LINCS |
| 2695 | DrugCentral |
| Citations |
|---|