EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2 |
| Net Charge | 0 |
| Average Mass | 160.220 |
| Monoisotopic Mass | 160.10005 |
| SMILES | c1ccc(CC2=NCCN2)cc1 |
| InChI | InChI=1S/C10H12N2/c1-2-4-9(5-3-1)8-10-11-6-7-12-10/h1-5H,6-8H2,(H,11,12) |
| InChIKey | JIVZKJJQOZQXQB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| Applications: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolazoline (CHEBI:28502) has role antihypertensive agent (CHEBI:35674) |
| tolazoline (CHEBI:28502) has role cardiovascular drug (CHEBI:35554) |
| tolazoline (CHEBI:28502) has role vasodilator agent (CHEBI:35620) |
| tolazoline (CHEBI:28502) has role α-adrenergic antagonist (CHEBI:37890) |
| tolazoline (CHEBI:28502) is a imidazoles (CHEBI:24780) |
| IUPAC Name |
|---|
| 2-benzyl-4,5-dihydro-1H-imidazole |
| INN | Source |
|---|---|
| tolazolina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-Benzyl-2-imidazoline | ChemIDplus |
| 2-Benzyl-4,5-imidazoline | ChemIDplus |
| 2-Benzylimidazoline | ChemIDplus |
| 4,5-Dihydro-2-(phenylmethyl)-1H-imidazole | KEGG COMPOUND |
| NSC-35110 | ChEMBL |
| Tolazine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2695 | DrugCentral |
| C07147 | KEGG COMPOUND |
| D08614 | KEGG DRUG |
| DB00797 | DrugBank |
| HMDB0014935 | HMDB |
| LSM-3020 | LINCS |
| Tolazoline | Wikipedia |
| Citations |
|---|