EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N4O5 |
| Net Charge | 0 |
| Average Mass | 258.234 |
| Monoisotopic Mass | 258.09642 |
| SMILES | [H][C@]1(CO)O[C@@]([H])(n2cnc(C(N)=O)c2N)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H14N4O5/c10-7-4(8(11)17)12-2-13(7)9-6(16)5(15)3(1-14)18-9/h2-3,5-6,9,14-16H,1,10H2,(H2,11,17)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | RTRQQBHATOEIAF-UUOKFMHZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acadesine (CHEBI:28498) has role antineoplastic agent (CHEBI:35610) |
| acadesine (CHEBI:28498) has role platelet aggregation inhibitor (CHEBI:50427) |
| acadesine (CHEBI:28498) is a 1-ribosylimidazolecarboxamide (CHEBI:26556) |
| acadesine (CHEBI:28498) is a aminoimidazole (CHEBI:22512) |
| acadesine (CHEBI:28498) is a nucleoside analogue (CHEBI:60783) |
| Incoming Relation(s) |
| AICA ribonucleotide (CHEBI:18406) has functional parent acadesine (CHEBI:28498) |
| IUPAC Name |
|---|
| 5-amino-1-(β-D-ribofuranosyl)-1H-imidazole-4-carboxamide |
| INNs | Source |
|---|---|
| acadesina | WHO MedNet |
| acadesine | WHO MedNet |
| acadésine | WHO MedNet |
| acadesinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-amino-1-ribofuranosylimidazole-4-carboxamide | ChEBI |
| 5-amino-1-β-ribofuranosyl-imidazole-4-carboxamide | ChemIDplus |
| 5-amino-1-β-D-ribofuranosyl-4-imidazolecarboxamide | ChemIDplus |
| 5-amino-1-β-D-ribofuranosylimidazole-4-carboxamide | ChemIDplus |
| 5-amino-1β-D-ribofuranosylimidazole-4-carboxyamide | ChemIDplus |
| 5-amino-4-imidazolecarboxamide ribofuranoside | ChemIDplus |
| Citations |
|---|