EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H24O12 |
| Net Charge | 0 |
| Average Mass | 576.510 |
| Monoisotopic Mass | 576.12678 |
| SMILES | Oc1cc(O)c2c(c1)O[C@@]1(c3ccc(O)c(O)c3)Oc3cc(O)c4c(c3[C@@H]2[C@H]1O)O[C@H](c1ccc(O)c(O)c1)[C@H](O)C4 |
| InChI | InChI=1S/C30H24O12/c31-13-7-20(37)24-22(8-13)41-30(12-2-4-16(33)19(36)6-12)29(39)26(24)25-23(42-30)10-17(34)14-9-21(38)27(40-28(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,21,26-27,29,31-39H,9H2/t21-,26-,27-,29-,30+/m1/s1 |
| InChIKey | NSEWTSAADLNHNH-LSBOWGMISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Applications: | angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| proanthocyanidin A2 (CHEBI:28472) has functional parent (−)-epicatechin (CHEBI:90) |
| proanthocyanidin A2 (CHEBI:28472) has role angiogenesis modulating agent (CHEBI:50926) |
| proanthocyanidin A2 (CHEBI:28472) has role anti-HIV agent (CHEBI:64946) |
| proanthocyanidin A2 (CHEBI:28472) has role antioxidant (CHEBI:22586) |
| proanthocyanidin A2 (CHEBI:28472) has role metabolite (CHEBI:25212) |
| proanthocyanidin A2 (CHEBI:28472) is a hydroxyflavan (CHEBI:72010) |
| proanthocyanidin A2 (CHEBI:28472) is a proanthocyanidin (CHEBI:26267) |
| IUPAC Name |
|---|
| (2R,3R,8S,14R,15R)-2,8-bis(3,4-dihydroxyphenyl)-3,4-dihydro-2H,14H-8,14-methanochromeno[7,8-d][1,3]benzodioxocine-3,5,11,13,15-pentol |
| Synonyms | Source |
|---|---|
| Epicatechin-(2β→7,4β→8)-epicatechin | ChEBI |
| Proanthocyanidin A2 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00002934 | KNApSAcK |
| C10237 | KEGG COMPOUND |
| HMDB0037655 | HMDB |
| Proanthocyanidin_A2 | Wikipedia |
| US2011275598 | Patent |
| WO2010086319 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1304336 | Reaxys |
| CAS:41743-41-3 | KEGG COMPOUND |
| CAS:41743-41-3 | ChemIDplus |
| Citations |
|---|