EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28454 - 3-selenino-L-alanine
| Formula | C3H7NO4Se |
| Net Charge | 0 |
| Average Mass | 200.052 |
| Monoisotopic Mass | 200.95403 |
| SMILES | N[C@@H](C[Se](=O)O)C(=O)O |
| InChI | InChI=1S/C3H7NO4Se/c4-2(3(5)6)1-9(7)8/h2H,1,4H2,(H,5,6)(H,7,8)/t2-/m0/s1 |
| InChIKey | CNQFMZMZJWKKEH-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-selenino-L-alanine (CHEBI:28454) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 3-selenino-L-alanine (CHEBI:28454) is a selenocysteines (CHEBI:26632) |
| Incoming Relation(s) |
| 3-selenino-L-alanine residue (CHEBI:61980) is substituent group from 3-selenino-L-alanine (CHEBI:28454) |
| IUPAC Name |
|---|
| 3-selenino-L-alanine |
| Synonyms | Source |
|---|---|
| Selenocysteine seleninic acid | KEGG COMPOUND |
| 3-Seleninoalanine | KEGG COMPOUND |
| (2R)-2-amino-3-selenino-propanoic acid | ChEBI |
| 3-seleninoalanine | ChEBI |
| Selenocysteine seleninate | KEGG COMPOUND |
| Citations |
|---|