EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O5 |
| Net Charge | 0 |
| Average Mass | 160.125 |
| Monoisotopic Mass | 160.03717 |
| SMILES | O=C1C[C@@H](O)[C@H](O)[C@@H](O)C1=O |
| InChI | InChI=1S/C6H8O5/c7-2-1-3(8)5(10)6(11)4(2)9/h2,4,6-7,9,11H,1H2/t2-,4+,6-/m1/s1 |
| InChIKey | SHFQRUVRUBHHRE-CJPQEGFPSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3D-3,5/4-trihydroxycyclohexane-1,2-dione (CHEBI:28446) is a 3,5/4-trihydroxycyclohexane-1,2-dione (CHEBI:16145) |
| 3D-3,5/4-trihydroxycyclohexane-1,2-dione (CHEBI:28446) is a secondary α-hydroxy ketone (CHEBI:2468) |
| 3D-3,5/4-trihydroxycyclohexane-1,2-dione (CHEBI:28446) is tautomer of (4R,5S,6R)-2,4,5,6-tetrahydroxycyclohex-2-en-1-one (CHEBI:4077) |
| Incoming Relation(s) |
| (4R,5S,6R)-2,4,5,6-tetrahydroxycyclohex-2-en-1-one (CHEBI:4077) is tautomer of 3D-3,5/4-trihydroxycyclohexane-1,2-dione (CHEBI:28446) |
| IUPAC Name |
|---|
| (3R,4S,5R)-3,4,5-trihydroxycyclohexane-1,2-dione |
| Synonyms | Source |
|---|---|
| 3,5/4-Trihydroxycyclohexa-1,2-dione | KEGG COMPOUND |
| (3R,4S,5R)-3,4,5-Trihydroxy-1,2-cyclohexanedione | KEGG COMPOUND |
| D-2,3-Diketo-4-deoxy-epi-inositol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 3D-3,5/4-trihydroxycyclohexane-1,2-dione | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C04287 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3199845 | Beilstein |
| CAS:949461-91-0 | KEGG COMPOUND |