EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H56N4O10 |
| Net Charge | 0 |
| Average Mass | 824.972 |
| Monoisotopic Mass | 824.39964 |
| SMILES | [H][C@@]12N(C=O)c3cc(OC)c([C@@]4(C(=O)OC)C[C@@H]5C[N@](CCc6c4nc4ccccc64)C[C@](O)(CC)C5)cc3[C@@]13CCN1CC=C[C@@](CC)([C@@H](OC(C)=O)[C@]2(O)C(=O)OC)[C@]13[H] |
| InChI | InChI=1S/C46H56N4O10/c1-7-42(55)22-28-23-45(40(53)58-5,36-30(14-18-48(24-28)25-42)29-12-9-10-13-33(29)47-36)32-20-31-34(21-35(32)57-4)50(26-51)38-44(31)16-19-49-17-11-15-43(8-2,37(44)49)39(60-27(3)52)46(38,56)41(54)59-6/h9-13,15,20-21,26,28,37-39,47,55-56H,7-8,14,16-19,22-25H2,1-6H3/t28-,37+,38-,39-,42+,43-,44-,45+,46+/m1/s1 |
| InChIKey | OGWKCGZFUXNPDA-XQKSVPLYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. tubulin modulator Any substance that interacts with tubulin to inhibit or promote polymerisation of microtubules. microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | drug Any substance which when absorbed into a living organism may modify one or more of its functions. The term is generally accepted for a substance taken for a therapeutic purpose, but is also commonly used for abused substances. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vincristine (CHEBI:28445) has parent hydride vincaleukoblastine (CHEBI:27375) |
| vincristine (CHEBI:28445) has role antineoplastic agent (CHEBI:35610) |
| vincristine (CHEBI:28445) has role drug (CHEBI:23888) |
| vincristine (CHEBI:28445) has role microtubule-destabilising agent (CHEBI:61951) |
| vincristine (CHEBI:28445) has role plant metabolite (CHEBI:76924) |
| vincristine (CHEBI:28445) has role tubulin modulator (CHEBI:60832) |
| vincristine (CHEBI:28445) is a acetate ester (CHEBI:47622) |
| vincristine (CHEBI:28445) is a formamides (CHEBI:24079) |
| vincristine (CHEBI:28445) is a methyl ester (CHEBI:25248) |
| vincristine (CHEBI:28445) is a organic heteropentacyclic compound (CHEBI:38164) |
| vincristine (CHEBI:28445) is a organic heterotetracyclic compound (CHEBI:38163) |
| vincristine (CHEBI:28445) is a tertiary alcohol (CHEBI:26878) |
| vincristine (CHEBI:28445) is a tertiary amino compound (CHEBI:50996) |
| vincristine (CHEBI:28445) is a vinca alkaloid (CHEBI:27288) |
| vincristine (CHEBI:28445) is conjugate base of vincristine(2+) (CHEBI:143658) |
| Incoming Relation(s) |
| vincristine(2+) (CHEBI:143658) is conjugate acid of vincristine (CHEBI:28445) |
| IUPAC Name |
|---|
| 22-oxovincaleukoblastine |
| Synonyms | Source |
|---|---|
| 22-oxo-vincaleukoblastine | DrugCentral |
| 22-Oxovincaleukoblastine | KEGG COMPOUND |
| leucristine | DrugCentral |
| leurocristine | ChemIDplus |
| oncovin | DrugCentral |
| vincristin | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2825 | DrugCentral |
| C00001783 | KNApSAcK |
| C07204 | KEGG COMPOUND |
| CPD-19894 | MetaCyc |
| D08679 | KEGG DRUG |
| DB00541 | DrugBank |
| HMDB0014681 | HMDB |
| Vincristine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4779289 | Beilstein |
| CAS:57-22-7 | KEGG COMPOUND |
| CAS:57-22-7 | ChemIDplus |
| Citations |
|---|