EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5Cl2NO |
| Net Charge | 0 |
| Average Mass | 190.029 |
| Monoisotopic Mass | 188.97482 |
| SMILES | NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C7H5Cl2NO/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H2,10,11) |
| InChIKey | JHSPCUHPSIUQRB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dichlorobenzamide (CHEBI:28435) has role herbicide (CHEBI:24527) |
| 2,6-dichlorobenzamide (CHEBI:28435) has role marine xenobiotic metabolite (CHEBI:83399) |
| 2,6-dichlorobenzamide (CHEBI:28435) is a benzamides (CHEBI:22702) |
| 2,6-dichlorobenzamide (CHEBI:28435) is a dichlorobenzene (CHEBI:23697) |
| IUPAC Name |
|---|
| 2,6-dichlorobenzamide |
| Synonyms | Source |
|---|---|
| 2,6-BAM | ChemIDplus |
| 2,6-Dichlorobenzamide | KEGG COMPOUND |
| 2,6-dichlorobenzoic acid amide | ChEBI |
| BAM | ChemIDplus |
| DCB | KEGG COMPOUND |
| Citations |
|---|