EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O8 |
| Net Charge | 0 |
| Average Mass | 320.253 |
| Monoisotopic Mass | 320.05322 |
| SMILES | O=C1c2c(O)cc(O)cc2O[C@H](c2cc(O)c(O)c(O)c2)[C@H]1O |
| InChI | InChI=1S/C15H12O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,14-20,22H/t14-,15+/m0/s1 |
| InChIKey | KJXSIXMJHKAJOD-LSDHHAIUSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ampelopsis cantoniensis (ncbitaxon:345095) | root (BTO:0001188) | PubMed (17059013) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-dihydromyricetin (CHEBI:28429) has role antineoplastic agent (CHEBI:35610) |
| (+)-dihydromyricetin (CHEBI:28429) has role antioxidant (CHEBI:22586) |
| (+)-dihydromyricetin (CHEBI:28429) has role metabolite (CHEBI:25212) |
| (+)-dihydromyricetin (CHEBI:28429) is a dihydromyricetin (CHEBI:28917) |
| (+)-dihydromyricetin (CHEBI:28429) is a secondary α-hydroxy ketone (CHEBI:2468) |
| (+)-dihydromyricetin (CHEBI:28429) is enantiomer of (−)-dihydromyricetin (CHEBI:48027) |
| Incoming Relation(s) |
| (−)-dihydromyricetin (CHEBI:48027) is enantiomer of (+)-dihydromyricetin (CHEBI:28429) |
| IUPAC Name |
|---|
| (2R,3R)-3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| (2R,3R)-2,3-dihydro-3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| (2R,3R)-3,3',4',5,5',7-hexahydroxy-2,3-dihydroflavanonol | ChEBI |
| (2R,3R)-3,5,7,3',4',5'-hexahydroxyflavanone | ChEBI |
| (+)-Ampelopsin | KEGG COMPOUND |
| Ampelopsin | KEGG COMPOUND |
| Ampeloptin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (2R,3R)-dihydromyricetin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000938 | KNApSAcK |
| C02906 | KEGG COMPOUND |
| CPD-7087 | MetaCyc |
| Dihydromyricetin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4331256 | Beilstein |
| Reaxys:5303758 | Reaxys |
| CAS:27200-12-0 | ChemIDplus |
| CAS:27200-12-0 | KEGG COMPOUND |
| Citations |
|---|