EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28428 - β-hexachlorocyclohexane
| Formula | C6H6Cl6 |
| Net Charge | 0 |
| Average Mass | 290.832 |
| Monoisotopic Mass | 287.86007 |
| SMILES | Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@H](Cl)[C@@H](Cl)[C@@H]1Cl |
| InChI | InChI=1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H/t1-,2-,3+,4+,5-,6- |
| InChIKey | JLYXXMFPNIAWKQ-CDRYSYESSA-N |
| Roles Classification |
|---|
| Chemical Role: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Application: | pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-hexachlorocyclohexane (CHEBI:28428) has role persistent organic pollutant (CHEBI:77853) |
| β-hexachlorocyclohexane (CHEBI:28428) is a hexachlorocyclohexane (CHEBI:24536) |
| β-hexachlorocyclohexane (CHEBI:28428) is a organochlorine pesticide (CHEBI:38656) |
| IUPAC Name |
|---|
| (1r,2t,3c,4t,5c,6t)-1,2,3,4,5,6-hexachlorocyclohexane |
| Synonyms | Source |
|---|---|
| (1α,2β,3α,4β,5α,6β)-1,2,3,4,5,6-hexachlorocyclohexane | NIST Chemistry WebBook |
| trans-1,2,3,4,5,6-hexachlorocyclohexane | NIST Chemistry WebBook |
| β-HCH | NIST Chemistry WebBook |
| β-lindane | NIST Chemistry WebBook |
| β-1,2,3,4,5,6-hexachlorocyclohexane | NIST Chemistry WebBook |
| β-BHC | NIST Chemistry WebBook |
| Citations |
|---|