EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5ClHgO2 |
| Net Charge | 0 |
| Average Mass | 357.158 |
| Monoisotopic Mass | 357.96845 |
| SMILES | O=C(O)c1cc[c]([Hg][Cl])cc1 |
| InChI | InChI=1S/C7H5O2.ClH.Hg/c8-7(9)6-4-2-1-3-5-6;;/h2-5H,(H,8,9);1H;/q;;+1/p-1 |
| InChIKey | YFZOUMNUDGGHIW-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-chloromercuribenzoic acid (CHEBI:28420) has functional parent benzoic acid (CHEBI:30746) |
| p-chloromercuribenzoic acid (CHEBI:28420) is a chlorine molecular entity (CHEBI:23117) |
| p-chloromercuribenzoic acid (CHEBI:28420) is a mercuribenzoic acid (CHEBI:25194) |
| IUPAC Name |
|---|
| (4-carboxyphenyl)chloromercury |
| Synonyms | Source |
|---|---|
| p-Chloromercuribenzoate | KEGG COMPOUND |
| p-Chloromercuribenzoic acid | KEGG COMPOUND |
| 4-carboxyphenylmercuric chloride | ChemIDplus |
| (p-carboxyphenyl)chloromercury | ChemIDplus |
| 4-chloromercuriobenzoic acid | ChemIDplus |
| 4-chloromercuribenzoic acid | ChemIDplus |