EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36N4O10 |
| Net Charge | 0 |
| Average Mass | 468.504 |
| Monoisotopic Mass | 468.24314 |
| SMILES | CN[C@H]1[C@H](O)[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H](N)C[C@H]2N)OC[C@@H]1O |
| InChI | InChI=1S/C18H36N4O10/c1-22-10-7(24)4-29-18(13(10)27)32-16-6(20)2-5(19)15(14(16)28)31-17-9(21)12(26)11(25)8(3-23)30-17/h5-18,22-28H,2-4,19-21H2,1H3/t5-,6+,7-,8+,9+,10+,11+,12+,13-,14-,15+,16-,17+,18-/m0/s1 |
| InChIKey | LKKVGKXCMYHKSL-LLZRLKDCSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gentamycin A (CHEBI:28418) is a gentamycin (CHEBI:17833) |
| IUPAC Name |
|---|
| (1R,2S,3S,4R,6S)-4,6-diamino-3-[3-deoxy-3-(methylamino)-α-L-xylopyranosyloxy]-2-hydroxycyclohexyl 2-amino-2-deoxy-α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Gentamicin A | KEGG COMPOUND |
| Gentamycin A | ChemIDplus |
| O-2-amino-2-deoxy-alpha-D-glucopyranosyl-(1-4)-O-(3-deoxy-3-(methylamino)-alpha-D-xylopyranosyl-(1-6))-2-deoxy-D-streptamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C01917 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:13291-74-2 | KEGG COMPOUND |