EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10OS2 |
| Net Charge | 0 |
| Average Mass | 162.279 |
| Monoisotopic Mass | 162.01731 |
| SMILES | C=CCSS(=O)CC=C |
| InChI | InChI=1S/C6H10OS2/c1-3-5-8-9(7)6-4-2/h3-4H,1-2,5-6H2 |
| InChIKey | JDLKFOPOAOFWQN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| allicin (CHEBI:28411) has role antibacterial agent (CHEBI:33282) |
| allicin (CHEBI:28411) is a botanical anti-fungal agent (CHEBI:86494) |
| allicin (CHEBI:28411) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| S-allyl prop-2-ene-1-sulfinothioate |
| Synonyms | Source |
|---|---|
| 2-Propene-1-sulfinothioic acid S-2-propenyl ester | KEGG COMPOUND |
| Allicin | KEGG COMPOUND |
| thio-2-propene-1-sulfinic acid S-allyl ester | ChEBI |
| UniProt Name | Source |
|---|---|
| allicin | UniProt |