EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15NO8 |
| Net Charge | 0 |
| Average Mass | 397.339 |
| Monoisotopic Mass | 397.07977 |
| SMILES | [H][C@@]12Cc3c(c(O)c4c(O)cccc4c3C)C(=O)[C@]1(O)C(=O)C(C(N)=O)=C(O)C2=O |
| InChI | InChI=1S/C20H15NO8/c1-6-7-3-2-4-10(22)11(7)15(24)12-8(6)5-9-14(23)16(25)13(19(21)28)18(27)20(9,29)17(12)26/h2-4,9,22,24-25,29H,5H2,1H3,(H2,21,28)/t9-,20-/m0/s1 |
| InChIKey | OJQSYBOSDDVFNO-LXGOIASLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces coelicolor (ncbitaxon:1902) | - | PubMed (18422316) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-de(dimethylamino)-4-oxoanhydrotetracycline (CHEBI:28408) has functional parent anhydrotetracycline (CHEBI:17146) |
| 4-de(dimethylamino)-4-oxoanhydrotetracycline (CHEBI:28408) has role bacterial metabolite (CHEBI:76969) |
| 4-de(dimethylamino)-4-oxoanhydrotetracycline (CHEBI:28408) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| 4-de(dimethylamino)-4-oxoanhydrotetracycline (CHEBI:28408) is a tetracyclines (CHEBI:26895) |
| 4-de(dimethylamino)-4-oxoanhydrotetracycline (CHEBI:28408) is conjugate acid of 4-de(dimethylamino)-4-oxoanhydrotetracycline(1−) (CHEBI:132737) |
| Incoming Relation(s) |
| 4-de(dimethylamino)-4-oxoanhydrotetracycline(1−) (CHEBI:132737) is conjugate base of 4-de(dimethylamino)-4-oxoanhydrotetracycline (CHEBI:28408) |
| IUPAC Name |
|---|
| (4aR,12aS)-3,10,11,12a-tetrahydroxy-6-methyl-1,4,12-trioxo-1,4,4a,5,12,12a-hexahydrotetracene-2-carboxamide |
| Synonyms | Source |
|---|---|
| 4-Dedimethylamino-4-oxo-anhydrotetracycline | KEGG COMPOUND |
| 4-Keto-ATC | KEGG COMPOUND |
| 4-Ketoanhydrotetracycline | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06627 | KEGG COMPOUND |
| LMPK07000007 | LIPID MAPS |
| CPD-19272 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2684416 | Reaxys |
| Citations |
|---|