EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O2 |
| Net Charge | 0 |
| Average Mass | 150.177 |
| Monoisotopic Mass | 150.06808 |
| SMILES | OCC=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O2/c10-7-1-2-8-3-5-9(11)6-4-8/h1-6,10-11H,7H2 |
| InChIKey | PTNLHDGQWUGONS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxycinnamyl alcohol (CHEBI:28386) has functional parent cinnamyl alcohol (CHEBI:17177) |
| 4-hydroxycinnamyl alcohol (CHEBI:28386) has role plant metabolite (CHEBI:76924) |
| 4-hydroxycinnamyl alcohol (CHEBI:28386) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| 4-hydroxycinnamyl alcohol 4-β-D-glucoside (CHEBI:27588) has functional parent 4-hydroxycinnamyl alcohol (CHEBI:28386) |
| trans-p-coumaryl alcohol (CHEBI:64555) is a 4-hydroxycinnamyl alcohol (CHEBI:28386) |
| IUPAC Name |
|---|
| 4-(3-hydroxyprop-1-en-1-yl)phenol |
| Synonyms | Source |
|---|---|
| 4-Coumaryl alcohol | KEGG COMPOUND |
| 4-Hydroxycinnamyl alcohol | KEGG COMPOUND |
| p-Coumaryl alcohol | KEGG COMPOUND |
| Citations |
|---|