EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N5O10P2 |
| Net Charge | 0 |
| Average Mass | 427.203 |
| Monoisotopic Mass | 427.02941 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O |
| InChI | InChI=1S/C10H15N5O10P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(25-27(20,21)22)6(16)4(24-10)1-23-26(17,18)19/h2-4,6-7,10,16H,1H2,(H2,11,12,13)(H2,17,18,19)(H2,20,21,22)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | AEOBEOJCBAYXBA-KQYNXXCUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adenosine 2',5'-bisphosphate (CHEBI:28355) is a adenosine bisphosphate (CHEBI:22251) |
| adenosine 2',5'-bisphosphate (CHEBI:28355) is conjugate acid of adenosine 2',5'-bisphosphate(4−) (CHEBI:194156) |
| Incoming Relation(s) |
| 2'-phospho-5'-adenylyl sulfate (CHEBI:848) has functional parent adenosine 2',5'-bisphosphate (CHEBI:28355) |
| adenosine 2',5'-bisphosphate(4−) (CHEBI:194156) is conjugate base of adenosine 2',5'-bisphosphate (CHEBI:28355) |
| Synonyms | Source |
|---|---|
| Adenosine 2',5'-bisphosphate | KEGG COMPOUND |
| adenosine 2',5'-bisphosphate | ChEBI |